C27H28INO6S — CID 137027234
ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137027234) has the molecular formula C27H28INO6S and a molecular weight of 621.49 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027234 |
| Molecular Formula | C27H28INO6S |
| Molecular Weight | 621.49 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(I)c(OCc3ccc(C)cc3)c(OCC)c2)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C27H28INO6S/c1-5-22(30)29-26-23(27(32)34-7-3)24(31)21(36-26)14-18-12-19(28)25(20(13-18)33-6-2)35-15-17-10-8-16(4)9-11-17/h8-14,31H,5-7,15H2,1-4H3/b21-14-,29-26- |
| InChIKey | IWCIGRYWPNBTAL-SHOHTREXSA-N |
| XLogP | 6.38 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|