C18H18INO6S — CID 137027267
ethyl (5Z)-4-hydroxy-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137027267) has the molecular formula C18H18INO6S and a molecular weight of 503.31 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027267 |
| Molecular Formula | C18H18INO6S |
| Molecular Weight | 503.31 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-2-propanoyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(I)c(O)c(OC)c2)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C18H18INO6S/c1-4-13(21)20-17-14(18(24)26-5-2)16(23)12(27-17)8-9-6-10(19)15(22)11(7-9)25-3/h6-8,22-23H,4-5H2,1-3H3/b12-8-,20-17- |
| InChIKey | BTMQHZZFGGOUNP-QNBKEOCXSA-N |
| XLogP | 3.80 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|