C20H19Br2NO5S — CID 137085515
ethyl (5Z)-5-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137085515) has the molecular formula C20H19Br2NO5S and a molecular weight of 545.25 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137085515 |
| Molecular Formula | C20H19Br2NO5S |
| Molecular Weight | 545.25 g/mol |
| Exact Mass | 542.94 |
| IUPAC Name | ethyl (5Z)-5-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
| SMILES | C=CCOc1c(Br)cc(/C=C2\S/C(=N\C(=O)CC)C(C(=O)OCC)=C2O)cc1Br |
| InChI | InChI=1S/C20H19Br2NO5S/c1-4-7-28-18-12(21)8-11(9-13(18)22)10-14-17(25)16(20(26)27-6-3)19(29-14)23-15(24)5-2/h4,8-10,25H,1,5-7H2,2-3H3/b14-10-,23-19- |
| InChIKey | LMUXYAXTSZMOIA-QONXIIGASA-N |
| XLogP | 5.57 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.25 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|