C21H23NO5S — CID 137086054
ethyl (5Z)-2-butanoylimino-4-hydroxy-5-[(4-prop-2-enoxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 137086054) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is ethyl (5Z)-2-butanoylimino-4-hydroxy-5-[(4-prop-2-enoxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-butanoylimino-4-hydroxy-5-[(4-prop-2-enoxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137086054 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | ethyl (5Z)-2-butanoylimino-4-hydroxy-5-[(4-prop-2-enoxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | C=CCOc1ccc(/C=C2\S/C(=N\C(=O)CCC)C(C(=O)OCC)=C2O)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-4-7-17(23)22-20-18(21(25)26-6-3)19(24)16(28-20)13-14-8-10-15(11-9-14)27-12-5-2/h5,8-11,13,24H,2,4,6-7,12H2,1,3H3/b16-13-,22-20- |
| InChIKey | ATLIISSGYWFJDK-JBBBKHMRSA-N |
| XLogP | 4.44 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|