C16H17NO5S — CID 137027181
ethyl (5Z)-2-butanoylimino-5-(furan-2-ylmethylidene)-4-hydroxythiophene-3-carboxylate (PubChem CID 137027181) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is ethyl (5Z)-2-butanoylimino-5-(furan-2-ylmethylidene)-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-butanoylimino-5-(furan-2-ylmethylidene)-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027181 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | ethyl (5Z)-2-butanoylimino-5-(furan-2-ylmethylidene)-4-hydroxythiophene-3-carboxylate |
| SMILES | CCCC(=O)/N=C1\S/C(=C\c2ccco2)C(O)=C1C(=O)OCC |
| InChI | InChI=1S/C16H17NO5S/c1-3-6-12(18)17-15-13(16(20)21-4-2)14(19)11(23-15)9-10-7-5-8-22-10/h5,7-9,19H,3-4,6H2,1-2H3/b11-9-,17-15- |
| InChIKey | IDGBCJJOSRAIDB-XINOORGGSA-N |
| XLogP | 3.47 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|