C21H20BrNO5S — CID 137085683
ethyl (5Z)-5-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]-2-butanoylimino-4-hydroxythiophene-3-carboxylate (PubChem CID 137085683) has the molecular formula C21H20BrNO5S and a molecular weight of 478.36 g/mol. Its IUPAC name is ethyl (5Z)-5-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]-2-butanoylimino-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]-2-butanoylimino-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137085683 |
| Molecular Formula | C21H20BrNO5S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | ethyl (5Z)-5-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]-2-butanoylimino-4-hydroxythiophene-3-carboxylate |
| SMILES | C#CCOc1ccc(Br)cc1/C=C1\S/C(=N\C(=O)CCC)C(C(=O)OCC)=C1O |
| InChI | InChI=1S/C21H20BrNO5S/c1-4-7-17(24)23-20-18(21(26)27-6-3)19(25)16(29-20)12-13-11-14(22)8-9-15(13)28-10-5-2/h2,8-9,11-12,25H,4,6-7,10H2,1,3H3/b16-12-,23-20- |
| InChIKey | IVYUWQLKXOIZTP-MVZWBTKSSA-N |
| XLogP | 4.65 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|