C22H25NO8S — CID 137027287
2-[4-[(Z)-(5-butanoylimino-4-ethoxycarbonyl-3-hydroxythiophen-2-ylidene)methyl]-2-ethoxyphenoxy]acetic acid (PubChem CID 137027287) has the molecular formula C22H25NO8S and a molecular weight of 463.51 g/mol. Its IUPAC name is 2-[4-[(Z)-(5-butanoylimino-4-ethoxycarbonyl-3-hydroxythiophen-2-ylidene)methyl]-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-(5-butanoylimino-4-ethoxycarbonyl-3-hydroxythiophen-2-ylidene)methyl]-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 137027287 |
| Molecular Formula | C22H25NO8S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 2-[4-[(Z)-(5-butanoylimino-4-ethoxycarbonyl-3-hydroxythiophen-2-ylidene)methyl]-2-ethoxyphenoxy]acetic acid |
| SMILES | CCCC(=O)/N=C1\S/C(=C\c2ccc(OCC(=O)O)c(OCC)c2)C(O)=C1C(=O)OCC |
| InChI | InChI=1S/C22H25NO8S/c1-4-7-17(24)23-21-19(22(28)30-6-3)20(27)16(32-21)11-13-8-9-14(31-12-18(25)26)15(10-13)29-5-2/h8-11,27H,4-7,12H2,1-3H3,(H,25,26)/b16-11-,23-21- |
| InChIKey | RPBHRUIOLAQKFA-JQRKVMPRSA-N |
| XLogP | 3.74 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|