C22H25NO6S — CID 137085810
ethyl (5Z)-2-butanoylimino-4-hydroxy-5-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 137085810) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is ethyl (5Z)-2-butanoylimino-4-hydroxy-5-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-butanoylimino-4-hydroxy-5-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137085810 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | ethyl (5Z)-2-butanoylimino-4-hydroxy-5-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | C=CCOc1ccc(/C=C2\S/C(=N\C(=O)CCC)C(C(=O)OCC)=C2O)cc1OC |
| InChI | InChI=1S/C22H25NO6S/c1-5-8-18(24)23-21-19(22(26)28-7-3)20(25)17(30-21)13-14-9-10-15(29-11-6-2)16(12-14)27-4/h6,9-10,12-13,25H,2,5,7-8,11H2,1,3-4H3/b17-13-,23-21- |
| InChIKey | KBLMQLBCMAQPIS-BTDREENWSA-N |
| XLogP | 4.45 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|