C22H22BrNO6S — CID 137026865
ethyl (5Z)-5-[(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137026865) has the molecular formula C22H22BrNO6S and a molecular weight of 508.39 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137026865 |
| Molecular Formula | C22H22BrNO6S |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | ethyl (5Z)-5-[(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
| SMILES | C#CCOc1c(Br)cc(/C=C2\S/C(=N\C(=O)CC)C(C(=O)OCC)=C2O)cc1OCC |
| InChI | InChI=1S/C22H22BrNO6S/c1-5-9-30-20-14(23)10-13(11-15(20)28-7-3)12-16-19(26)18(22(27)29-8-4)21(31-16)24-17(25)6-2/h1,10-12,26H,6-9H2,2-4H3/b16-12-,24-21- |
| InChIKey | MQWOACPYZWFBPT-LQHOMPMXSA-N |
| XLogP | 4.66 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|