C19H21NO6S — CID 137027164
ethyl (5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137027164) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is ethyl (5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027164 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | ethyl (5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cccc(OC)c2OC)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C19H21NO6S/c1-5-14(21)20-18-15(19(23)26-6-2)16(22)13(27-18)10-11-8-7-9-12(24-3)17(11)25-4/h7-10,22H,5-6H2,1-4H3/b13-10-,20-18- |
| InChIKey | RWVSLORYVFOUTC-RYYYRXALSA-N |
| XLogP | 3.50 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|