C18H17I2NO5S — CID 137027096
ethyl (5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137027096) has the molecular formula C18H17I2NO5S and a molecular weight of 613.21 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027096 |
| Molecular Formula | C18H17I2NO5S |
| Molecular Weight | 613.21 g/mol |
| Exact Mass | 612.89 |
| IUPAC Name | ethyl (5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(I)cc(I)c2OC)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C18H17I2NO5S/c1-4-13(22)21-17-14(18(24)26-5-2)15(23)12(27-17)7-9-6-10(19)8-11(20)16(9)25-3/h6-8,23H,4-5H2,1-3H3/b12-7-,21-17- |
| InChIKey | ONCNGSGIHIVOJW-MLTVIAHUSA-N |
| XLogP | 4.70 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|