C24H21BrINO5S — CID 137085569
ethyl (5Z)-5-[[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137085569) has the molecular formula C24H21BrINO5S and a molecular weight of 642.31 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137085569 |
| Molecular Formula | C24H21BrINO5S |
| Molecular Weight | 642.31 g/mol |
| Exact Mass | 640.94 |
| IUPAC Name | ethyl (5Z)-5-[[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(OCc3ccc(I)cc3)c(Br)c2)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C24H21BrINO5S/c1-3-20(28)27-23-21(24(30)31-4-2)22(29)19(33-23)12-15-7-10-18(17(25)11-15)32-13-14-5-8-16(26)9-6-14/h5-12,29H,3-4,13H2,1-2H3/b19-12-,27-23- |
| InChIKey | YQJPJFWFBJKRHG-YGRFHKKUSA-N |
| XLogP | 6.43 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.31 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|