C25H23BrN2O7S — CID 137027379
ethyl (5Z)-5-[[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-butanoylimino-4-hydroxythiophene-3-carboxylate (PubChem CID 137027379) has the molecular formula C25H23BrN2O7S and a molecular weight of 575.44 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-butanoylimino-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-butanoylimino-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027379 |
| Molecular Formula | C25H23BrN2O7S |
| Molecular Weight | 575.44 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | ethyl (5Z)-5-[[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-butanoylimino-4-hydroxythiophene-3-carboxylate |
| SMILES | CCCC(=O)/N=C1\S/C(=C\c2ccc(OCc3ccc([N+](=O)[O-])cc3)c(Br)c2)C(O)=C1C(=O)OCC |
| InChI | InChI=1S/C25H23BrN2O7S/c1-3-5-21(29)27-24-22(25(31)34-4-2)23(30)20(36-24)13-16-8-11-19(18(26)12-16)35-14-15-6-9-17(10-7-15)28(32)33/h6-13,30H,3-5,14H2,1-2H3/b20-13-,27-24- |
| InChIKey | LJOMAFAPZVJYCA-CXEDADEWSA-N |
| XLogP | 6.12 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|