C24H21ClN2O7S — CID 137027340
ethyl (5Z)-5-[[3-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137027340) has the molecular formula C24H21ClN2O7S and a molecular weight of 516.96 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027340 |
| Molecular Formula | C24H21ClN2O7S |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | ethyl (5Z)-5-[[3-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(OCc3cccc([N+](=O)[O-])c3)c(Cl)c2)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C24H21ClN2O7S/c1-3-20(28)26-23-21(24(30)33-4-2)22(29)19(35-23)12-14-8-9-18(17(25)11-14)34-13-15-6-5-7-16(10-15)27(31)32/h5-12,29H,3-4,13H2,1-2H3/b19-12-,26-23- |
| InChIKey | BOSMXPGLWRZMSX-QJLDTMHYSA-N |
| XLogP | 5.63 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|