C25H22Cl2INO5S — CID 137086006
ethyl (5Z)-2-butanoylimino-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 137086006) has the molecular formula C25H22Cl2INO5S and a molecular weight of 646.33 g/mol. Its IUPAC name is ethyl (5Z)-2-butanoylimino-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-butanoylimino-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137086006 |
| Molecular Formula | C25H22Cl2INO5S |
| Molecular Weight | 646.33 g/mol |
| Exact Mass | 644.96 |
| IUPAC Name | ethyl (5Z)-2-butanoylimino-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCCC(=O)/N=C1\S/C(=C\c2cc(Cl)c(OCc3ccc(I)cc3)c(Cl)c2)C(O)=C1C(=O)OCC |
| InChI | InChI=1S/C25H22Cl2INO5S/c1-3-5-20(30)29-24-21(25(32)33-4-2)22(31)19(35-24)12-15-10-17(26)23(18(27)11-15)34-13-14-6-8-16(28)9-7-14/h6-12,31H,3-5,13H2,1-2H3/b19-12-,29-24- |
| InChIKey | WTWFVYVRVBDQFB-HVAANJTRSA-N |
| XLogP | 7.37 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.33 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|