C29H26INO5S — CID 137120730
ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137120730) has the molecular formula C29H26INO5S and a molecular weight of 627.50 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137120730 |
| Molecular Formula | C29H26INO5S |
| Molecular Weight | 627.50 g/mol |
| Exact Mass | 627.06 |
| IUPAC Name | ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(I)c(OCc3ccccc3)c(OCC)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C29H26INO5S/c1-3-34-23-16-20(15-22(30)27(23)36-18-19-11-7-5-8-12-19)17-24-26(32)25(29(33)35-4-2)28(37-24)31-21-13-9-6-10-14-21/h5-17,32H,3-4,18H2,1-2H3/b24-17-,31-28- |
| InChIKey | XMEYQYQZCCBLJB-SHTXSOMYSA-N |
| XLogP | 7.46 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.50 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|