C27H20BrFINO4S — CID 137022619
ethyl (5Z)-5-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137022619) has the molecular formula C27H20BrFINO4S and a molecular weight of 680.33 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137022619 |
| Molecular Formula | C27H20BrFINO4S |
| Molecular Weight | 680.33 g/mol |
| Exact Mass | 678.93 |
| IUPAC Name | ethyl (5Z)-5-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(Br)c(OCc3cccc(F)c3)c(I)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C27H20BrFINO4S/c1-2-34-27(33)23-24(32)22(36-26(23)31-19-9-4-3-5-10-19)14-17-12-20(28)25(21(30)13-17)35-15-16-7-6-8-18(29)11-16/h3-14,32H,2,15H2,1H3/b22-14-,31-26- |
| InChIKey | OODQNSTXYSLOCZ-KIJHLXIESA-N |
| XLogP | 7.96 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.33 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|