C27H19BrCl2INO4S — CID 137022654
ethyl (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-iodophenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137022654) has the molecular formula C27H19BrCl2INO4S and a molecular weight of 731.23 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-iodophenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-iodophenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137022654 |
| Molecular Formula | C27H19BrCl2INO4S |
| Molecular Weight | 731.23 g/mol |
| Exact Mass | 728.86 |
| IUPAC Name | ethyl (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-iodophenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(Br)c(OCc3ccc(Cl)c(Cl)c3)c(I)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C27H19BrCl2INO4S/c1-2-35-27(34)23-24(33)22(37-26(23)32-17-6-4-3-5-7-17)13-16-10-18(28)25(21(31)12-16)36-14-15-8-9-19(29)20(30)11-15/h3-13,33H,2,14H2,1H3/b22-13-,32-26- |
| InChIKey | DOXZUKZONUUHLS-PYRPFXRSSA-N |
| XLogP | 9.13 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.23 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|