C20H15Cl2NO3S — CID 135438760
ethyl (5Z)-5-[(3,4-dichlorophenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 135438760) has the molecular formula C20H15Cl2NO3S and a molecular weight of 420.32 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3,4-dichlorophenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3,4-dichlorophenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135438760 |
| Molecular Formula | C20H15Cl2NO3S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | ethyl (5Z)-5-[(3,4-dichlorophenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(Cl)c(Cl)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C20H15Cl2NO3S/c1-2-26-20(25)17-18(24)16(11-12-8-9-14(21)15(22)10-12)27-19(17)23-13-6-4-3-5-7-13/h3-11,24H,2H2,1H3/b16-11-,23-19- |
| InChIKey | QQOCWATWMJTPCI-QUCAZCOOSA-N |
| XLogP | 6.19 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|