C24H24ClNO5S — CID 137121083
ethyl (5Z)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137121083) has the molecular formula C24H24ClNO5S and a molecular weight of 473.98 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137121083 |
| Molecular Formula | C24H24ClNO5S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | ethyl (5Z)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(Cl)c(OCC)c(OCC)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C24H24ClNO5S/c1-4-29-18-13-15(12-17(25)22(18)30-5-2)14-19-21(27)20(24(28)31-6-3)23(32-19)26-16-10-8-7-9-11-16/h7-14,27H,4-6H2,1-3H3/b19-14-,26-23- |
| InChIKey | GBKUGBGUPQCGSZ-QFMGQSSSSA-N |
| XLogP | 6.33 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|