C35H30INO6S — CID 137022554
ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate (PubChem CID 137022554) has the molecular formula C35H30INO6S and a molecular weight of 719.60 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137022554 |
| Molecular Formula | C35H30INO6S |
| Molecular Weight | 719.60 g/mol |
| Exact Mass | 719.08 |
| IUPAC Name | ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(I)c(OCc3cccc4ccccc34)c(OCC)c2)S/C1=N\C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H30INO6S/c1-4-41-28-18-22(17-27(36)32(28)43-20-25-11-8-10-23-9-6-7-12-26(23)25)19-29-31(38)30(35(40)42-5-2)34(44-29)37-33(39)24-15-13-21(3)14-16-24/h6-19,38H,4-5,20H2,1-3H3/b29-19-,37-34- |
| InChIKey | GWVTUNMZDCROBB-ZLIUZKCWSA-N |
| XLogP | 8.43 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.60 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|