C26H21NO4S — CID 137022679
ethyl (5Z)-4-hydroxy-2-(4-methylbenzoyl)imino-5-(naphthalen-1-ylmethylidene)thiophene-3-carboxylate (PubChem CID 137022679) has the molecular formula C26H21NO4S and a molecular weight of 443.52 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-2-(4-methylbenzoyl)imino-5-(naphthalen-1-ylmethylidene)thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-2-(4-methylbenzoyl)imino-5-(naphthalen-1-ylmethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137022679 |
| Molecular Formula | C26H21NO4S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-2-(4-methylbenzoyl)imino-5-(naphthalen-1-ylmethylidene)thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cccc3ccccc23)S/C1=N\C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H21NO4S/c1-3-31-26(30)22-23(28)21(15-19-9-6-8-17-7-4-5-10-20(17)19)32-25(22)27-24(29)18-13-11-16(2)12-14-18/h4-15,28H,3H2,1-2H3/b21-15-,27-25- |
| InChIKey | WZIHAGSSURUOPF-USZFSVTMSA-N |
| XLogP | 5.85 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|