C29H22Cl2INO5S — CID 137022671
ethyl (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate (PubChem CID 137022671) has the molecular formula C29H22Cl2INO5S and a molecular weight of 694.37 g/mol. Its IUPAC name is ethyl (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137022671 |
| Molecular Formula | C29H22Cl2INO5S |
| Molecular Weight | 694.37 g/mol |
| Exact Mass | 692.96 |
| IUPAC Name | ethyl (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(OCc3ccc(Cl)cc3Cl)c(I)c2)S/C1=N\C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H22Cl2INO5S/c1-3-37-29(36)25-26(34)24(39-28(25)33-27(35)18-7-4-16(2)5-8-18)13-17-6-11-23(22(32)12-17)38-15-19-9-10-20(30)14-21(19)31/h4-14,34H,3,15H2,1-2H3/b24-13-,33-28- |
| InChIKey | XAEYNHHNKTUGGS-RKDVFZSSSA-N |
| XLogP | 8.19 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.37 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|