C26H22ClNO6S — CID 137170468
ethyl (5Z)-5-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate (PubChem CID 137170468) has the molecular formula C26H22ClNO6S and a molecular weight of 511.98 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137170468 |
| Molecular Formula | C26H22ClNO6S |
| Molecular Weight | 511.98 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | ethyl (5Z)-5-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate |
| SMILES | C#CCOc1c(Cl)cc(/C=C2\S/C(=N\C(=O)c3ccccc3C)C(C(=O)OCC)=C2O)cc1OC |
| InChI | InChI=1S/C26H22ClNO6S/c1-5-11-34-23-18(27)12-16(13-19(23)32-4)14-20-22(29)21(26(31)33-6-2)25(35-20)28-24(30)17-10-8-7-9-15(17)3/h1,7-10,12-14,29H,6,11H2,2-4H3/b20-14-,28-25- |
| InChIKey | QDKWEARBUMWIGD-ARIIHFJZSA-N |
| XLogP | 5.37 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.98 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|