C23H20INO4S — CID 137022650
ethyl (5Z)-4-hydroxy-5-[(3-iodo-4-prop-2-enoxyphenyl)methylidene]-2-phenyliminothiophene-3-carboxylate (PubChem CID 137022650) has the molecular formula C23H20INO4S and a molecular weight of 533.39 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-5-[(3-iodo-4-prop-2-enoxyphenyl)methylidene]-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-5-[(3-iodo-4-prop-2-enoxyphenyl)methylidene]-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137022650 |
| Molecular Formula | C23H20INO4S |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-5-[(3-iodo-4-prop-2-enoxyphenyl)methylidene]-2-phenyliminothiophene-3-carboxylate |
| SMILES | C=CCOc1ccc(/C=C2\S/C(=N\c3ccccc3)C(C(=O)OCC)=C2O)cc1I |
| InChI | InChI=1S/C23H20INO4S/c1-3-12-29-18-11-10-15(13-17(18)24)14-19-21(26)20(23(27)28-4-2)22(30-19)25-16-8-6-5-7-9-16/h3,5-11,13-14,26H,1,4,12H2,2H3/b19-14-,25-22- |
| InChIKey | POQOOZNALHFHDE-HZLKLEQGSA-N |
| XLogP | 6.05 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|