C23H25N3O2 — CID 59672435
(5E)-3-ethyl-5-[(9-ethylcarbazol-3-yl)methylidene]-2-propylimino-1,3-oxazolidin-4-one (PubChem CID 59672435) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[(9-ethylcarbazol-3-yl)methylidene]-2-propylimino-1,3-oxazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-[(9-ethylcarbazol-3-yl)methylidene]-2-propylimino-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 59672435 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (5E)-3-ethyl-5-[(9-ethylcarbazol-3-yl)methylidene]-2-propylimino-1,3-oxazolidin-4-one |
| SMILES | CCC/N=C1\O/C(=C/c2ccc3c(c2)c2ccccc2n3CC)C(=O)N1CC |
| InChI | InChI=1S/C23H25N3O2/c1-4-13-24-23-26(6-3)22(27)21(28-23)15-16-11-12-20-18(14-16)17-9-7-8-10-19(17)25(20)5-2/h7-12,14-15H,4-6,13H2,1-3H3/b21-15+,24-23- |
| InChIKey | DKVQLQWSMDZAOQ-NVZLDUMVSA-N |
| XLogP | 4.80 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|