C22H17N3O2S — CID 72583339
3-[4-oxo-5-[(9-prop-2-enylcarbazol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-3-yl]propanenitrile (PubChem CID 72583339) has the molecular formula C22H17N3O2S and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-[4-oxo-5-[(9-prop-2-enylcarbazol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-3-yl]propanenitrile.
| Compound Name | 3-[4-oxo-5-[(9-prop-2-enylcarbazol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-3-yl]propanenitrile |
|---|---|
| PubChem CID | 72583339 |
| Molecular Formula | C22H17N3O2S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[4-oxo-5-[(9-prop-2-enylcarbazol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-3-yl]propanenitrile |
| SMILES | C=CCn1c2ccccc2c2cc(C=C3OC(=S)N(CCC#N)C3=O)ccc21 |
| InChI | InChI=1S/C22H17N3O2S/c1-2-11-24-18-7-4-3-6-16(18)17-13-15(8-9-19(17)24)14-20-21(26)25(12-5-10-23)22(28)27-20/h2-4,6-9,13-14H,1,5,11-12H2 |
| InChIKey | WGCGHGARTGRKSN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|