C30H26N2O3 — CID 76826435
3-[2-(cyclohexen-1-yl)ethyl]-5-[(9-phenylcarbazol-3-yl)methylidene]-1,3-oxazolidine-2,4-dione (PubChem CID 76826435) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-5-[(9-phenylcarbazol-3-yl)methylidene]-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-5-[(9-phenylcarbazol-3-yl)methylidene]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 76826435 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-5-[(9-phenylcarbazol-3-yl)methylidene]-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1OC(=Cc2ccc3c(c2)c2ccccc2n3-c2ccccc2)C(=O)N1CCC1=CCCCC1 |
| InChI | InChI=1S/C30H26N2O3/c33-29-28(35-30(34)31(29)18-17-21-9-3-1-4-10-21)20-22-15-16-27-25(19-22)24-13-7-8-14-26(24)32(27)23-11-5-2-6-12-23/h2,5-9,11-16,19-20H,1,3-4,10,17-18H2 |
| InChIKey | LHDHNGNBRMGBDQ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|