C25H21N3OS — CID 72540252
3-ethyl-1-methyl-5-[(9-phenylcarbazol-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 72540252) has the molecular formula C25H21N3OS and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-ethyl-1-methyl-5-[(9-phenylcarbazol-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-ethyl-1-methyl-5-[(9-phenylcarbazol-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 72540252 |
| Molecular Formula | C25H21N3OS |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 3-ethyl-1-methyl-5-[(9-phenylcarbazol-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)C(=Cc2ccc3c(c2)c2ccccc2n3-c2ccccc2)N(C)C1=S |
| InChI | InChI=1S/C25H21N3OS/c1-3-27-24(29)23(26(2)25(27)30)16-17-13-14-22-20(15-17)19-11-7-8-12-21(19)28(22)18-9-5-4-6-10-18/h4-16H,3H2,1-2H3 |
| InChIKey | HIFAKRSXJGUQNW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|