C40H40N4O4 — CID 58587358
ethyl 2-[[1,3-dibutyl-4,6-dioxo-5-[(9-phenylcarbazol-3-yl)methylidene]-1,3-diazinan-2-ylidene]amino]benzoate (PubChem CID 58587358) has the molecular formula C40H40N4O4 and a molecular weight of 640.78 g/mol. Its IUPAC name is ethyl 2-[[1,3-dibutyl-4,6-dioxo-5-[(9-phenylcarbazol-3-yl)methylidene]-1,3-diazinan-2-ylidene]amino]benzoate.
| Compound Name | ethyl 2-[[1,3-dibutyl-4,6-dioxo-5-[(9-phenylcarbazol-3-yl)methylidene]-1,3-diazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 58587358 |
| Molecular Formula | C40H40N4O4 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | ethyl 2-[[1,3-dibutyl-4,6-dioxo-5-[(9-phenylcarbazol-3-yl)methylidene]-1,3-diazinan-2-ylidene]amino]benzoate |
| SMILES | CCCCN1C(=O)C(=Cc2ccc3c(c2)c2ccccc2n3-c2ccccc2)C(=O)N(CCCC)C1=Nc1ccccc1C(=O)OCC |
| InChI | InChI=1S/C40H40N4O4/c1-4-7-24-42-37(45)33(38(46)43(25-8-5-2)40(42)41-34-20-14-12-19-31(34)39(47)48-6-3)27-28-22-23-36-32(26-28)30-18-13-15-21-35(30)44(36)29-16-10-9-11-17-29/h9-23,26-27H,4-8,24-25H2,1-3H3/b33-27-,41-40+ |
| InChIKey | WYCCLZMVJCUCQX-QYEUCGQGSA-N |
| XLogP | 8.30 |
| TPSA | 84.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|