C25H27N3O3 — CID 102493953
5-[(9-octylcarbazol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 102493953) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 5-[(9-octylcarbazol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(9-octylcarbazol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 102493953 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 5-[(9-octylcarbazol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCCn1c2ccccc2c2cc(C=C3C(=O)NC(=O)NC3=O)ccc21 |
| InChI | InChI=1S/C25H27N3O3/c1-2-3-4-5-6-9-14-28-21-11-8-7-10-18(21)19-15-17(12-13-22(19)28)16-20-23(29)26-25(31)27-24(20)30/h7-8,10-13,15-16H,2-6,9,14H2,1H3,(H2,26,27,29,30,31) |
| InChIKey | HNGQYDKHXPWISZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|