C42H42N2O6 — CID 58755464
ethyl (4Z)-1-butyl-4-[[4-[(Z)-[4-ethoxycarbonyl-1-(2-methylprop-2-enyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]phenyl]methylidene]-5-oxo-2-phenylpyrrole-3-carboxylate (PubChem CID 58755464) has the molecular formula C42H42N2O6 and a molecular weight of 670.81 g/mol. Its IUPAC name is ethyl (4Z)-1-butyl-4-[[4-[(Z)-[4-ethoxycarbonyl-1-(2-methylprop-2-enyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]phenyl]methylidene]-5-oxo-2-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl (4Z)-1-butyl-4-[[4-[(Z)-[4-ethoxycarbonyl-1-(2-methylprop-2-enyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]phenyl]methylidene]-5-oxo-2-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 58755464 |
| Molecular Formula | C42H42N2O6 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | ethyl (4Z)-1-butyl-4-[[4-[(Z)-[4-ethoxycarbonyl-1-(2-methylprop-2-enyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]phenyl]methylidene]-5-oxo-2-phenylpyrrole-3-carboxylate |
| SMILES | C=C(C)CN1C(=O)/C(=C\c2ccc(/C=C3\C(=O)N(CCCC)C(c4ccccc4)=C3C(=O)OCC)cc2)C(C(=O)OCC)=C1c1ccccc1 |
| InChI | InChI=1S/C42H42N2O6/c1-6-9-24-43-37(31-16-12-10-13-17-31)35(41(47)49-7-2)33(39(43)45)25-29-20-22-30(23-21-29)26-34-36(42(48)50-8-3)38(32-18-14-11-15-19-32)44(40(34)46)27-28(4)5/h10-23,25-26H,4,6-9,24,27H2,1-3,5H3/b33-25-,34-26- |
| InChIKey | UVVKWYSTAQCAPR-LYWFMZLMSA-N |
| XLogP | 7.46 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|