C18H20FNO3 — CID 126208151
methyl (4Z)-1-butyl-4-[(3-fluorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126208151) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is methyl (4Z)-1-butyl-4-[(3-fluorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-butyl-4-[(3-fluorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126208151 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl (4Z)-1-butyl-4-[(3-fluorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCCCN1C(=O)/C(=C\c2cccc(F)c2)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C18H20FNO3/c1-4-5-9-20-12(2)16(18(22)23-3)15(17(20)21)11-13-7-6-8-14(19)10-13/h6-8,10-11H,4-5,9H2,1-3H3/b15-11- |
| InChIKey | RHSYKMPATSGUOQ-PTNGSMBKSA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|