C30H29NO6 — CID 21373262
methyl (4Z)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxo-4-[(3-phenoxyphenyl)methylidene]pyrrole-3-carboxylate (PubChem CID 21373262) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is methyl (4Z)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxo-4-[(3-phenoxyphenyl)methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxo-4-[(3-phenoxyphenyl)methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 21373262 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | methyl (4Z)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-5-oxo-4-[(3-phenoxyphenyl)methylidene]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(CCc2ccc(OC)c(OC)c2)C(=O)/C1=C\c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C30H29NO6/c1-20-28(30(33)36-4)25(18-22-9-8-12-24(17-22)37-23-10-6-5-7-11-23)29(32)31(20)16-15-21-13-14-26(34-2)27(19-21)35-3/h5-14,17-19H,15-16H2,1-4H3/b25-18- |
| InChIKey | RVNAPQCOVCXDRW-BWAHOGKJSA-N |
| XLogP | 5.41 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|