C28H25NO6 — CID 6109153
methyl (4Z)-1-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-[(3-phenoxyphenyl)methylidene]pyrrole-3-carboxylate (PubChem CID 6109153) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is methyl (4Z)-1-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-[(3-phenoxyphenyl)methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-[(3-phenoxyphenyl)methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 6109153 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | methyl (4Z)-1-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-[(3-phenoxyphenyl)methylidene]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(OC)c(OC)c2)C(=O)/C1=C\c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H25NO6/c1-18-26(28(31)34-4)23(27(30)29(18)20-13-14-24(32-2)25(17-20)33-3)16-19-9-8-12-22(15-19)35-21-10-6-5-7-11-21/h5-17H,1-4H3/b23-16- |
| InChIKey | VEOROXWYQWZNJD-KQWNVCNZSA-N |
| XLogP | 5.37 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|