C22H19Cl2NO5 — CID 126058453
methyl (4Z)-4-[(2,3-dichlorophenyl)methylidene]-1-(3,4-dimethoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126058453) has the molecular formula C22H19Cl2NO5 and a molecular weight of 448.30 g/mol. Its IUPAC name is methyl (4Z)-4-[(2,3-dichlorophenyl)methylidene]-1-(3,4-dimethoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-4-[(2,3-dichlorophenyl)methylidene]-1-(3,4-dimethoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126058453 |
| Molecular Formula | C22H19Cl2NO5 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | methyl (4Z)-4-[(2,3-dichlorophenyl)methylidene]-1-(3,4-dimethoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(OC)c(OC)c2)C(=O)/C1=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H19Cl2NO5/c1-12-19(22(27)30-4)15(10-13-6-5-7-16(23)20(13)24)21(26)25(12)14-8-9-17(28-2)18(11-14)29-3/h5-11H,1-4H3/b15-10- |
| InChIKey | GBHWNLMLQWHERP-GDNBJRDFSA-N |
| XLogP | 4.89 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|