C24H17Cl2NO3 — CID 6024463
methyl (4Z)-4-[(2,3-dichlorophenyl)methylidene]-2-methyl-1-naphthalen-1-yl-5-oxopyrrole-3-carboxylate (PubChem CID 6024463) has the molecular formula C24H17Cl2NO3 and a molecular weight of 438.31 g/mol. Its IUPAC name is methyl (4Z)-4-[(2,3-dichlorophenyl)methylidene]-2-methyl-1-naphthalen-1-yl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-4-[(2,3-dichlorophenyl)methylidene]-2-methyl-1-naphthalen-1-yl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 6024463 |
| Molecular Formula | C24H17Cl2NO3 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | methyl (4Z)-4-[(2,3-dichlorophenyl)methylidene]-2-methyl-1-naphthalen-1-yl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2cccc3ccccc23)C(=O)/C1=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H17Cl2NO3/c1-14-21(24(29)30-2)18(13-16-9-5-11-19(25)22(16)26)23(28)27(14)20-12-6-8-15-7-3-4-10-17(15)20/h3-13H,1-2H3/b18-13- |
| InChIKey | LXOFOWJDYVPFPM-AQTBWJFISA-N |
| XLogP | 6.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|