C31H25NO4 — CID 6048257
methyl (4Z)-2-methyl-1-naphthalen-1-yl-5-oxo-4-[(3-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate (PubChem CID 6048257) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is methyl (4Z)-2-methyl-1-naphthalen-1-yl-5-oxo-4-[(3-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-2-methyl-1-naphthalen-1-yl-5-oxo-4-[(3-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 6048257 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | methyl (4Z)-2-methyl-1-naphthalen-1-yl-5-oxo-4-[(3-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2cccc3ccccc23)C(=O)/C1=C\c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H25NO4/c1-21-29(31(34)35-2)27(30(33)32(21)28-17-9-14-24-13-6-7-16-26(24)28)19-23-12-8-15-25(18-23)36-20-22-10-4-3-5-11-22/h3-19H,20H2,1-2H3/b27-19- |
| InChIKey | FCQOPYVYCCDOKB-DIBXZPPDSA-N |
| XLogP | 6.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|