C27H24N2O4 — CID 58785600
(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-1,3-oxazolidine-2,4-dione (PubChem CID 58785600) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-1,3-oxazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 58785600 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-1,3-oxazolidine-2,4-dione |
| SMILES | CCOc1ccc(CN2C(=O)O/C(=C/c3ccc4c(c3)c3ccccc3n4CC)C2=O)cc1 |
| InChI | InChI=1S/C27H24N2O4/c1-3-28-23-8-6-5-7-21(23)22-15-19(11-14-24(22)28)16-25-26(30)29(27(31)33-25)17-18-9-12-20(13-10-18)32-4-2/h5-16H,3-4,17H2,1-2H3/b25-16+ |
| InChIKey | BDBLFBBLNLUDCJ-PCLIKHOPSA-N |
| XLogP | 5.73 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|