C34H29N3O4 — CID 88933371
4-[[(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzaldehyde (PubChem CID 88933371) has the molecular formula C34H29N3O4 and a molecular weight of 543.62 g/mol. Its IUPAC name is 4-[[(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzaldehyde.
| Compound Name | 4-[[(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzaldehyde |
|---|---|
| PubChem CID | 88933371 |
| Molecular Formula | C34H29N3O4 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 4-[[(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzaldehyde |
| SMILES | CCOc1ccc(CN2C(=O)/C(=C\c3ccc4c(c3)c3ccccc3n4CC)O/C2=N\c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C34H29N3O4/c1-3-36-30-8-6-5-7-28(30)29-19-25(13-18-31(29)36)20-32-33(39)37(21-23-11-16-27(17-12-23)40-4-2)34(41-32)35-26-14-9-24(22-38)10-15-26/h5-20,22H,3-4,21H2,1-2H3/b32-20+,35-34- |
| InChIKey | MXNJSZISSNKNBW-MRGJITKLSA-N |
| XLogP | 7.11 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|