C18H15NO5 — CID 76625275
methyl 3-[5-(naphthalen-2-ylmethylidene)-2,4-dioxo-1,3-oxazolidin-3-yl]propanoate (PubChem CID 76625275) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is methyl 3-[5-(naphthalen-2-ylmethylidene)-2,4-dioxo-1,3-oxazolidin-3-yl]propanoate.
| Compound Name | methyl 3-[5-(naphthalen-2-ylmethylidene)-2,4-dioxo-1,3-oxazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 76625275 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | methyl 3-[5-(naphthalen-2-ylmethylidene)-2,4-dioxo-1,3-oxazolidin-3-yl]propanoate |
| SMILES | COC(=O)CCN1C(=O)OC(=Cc2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C18H15NO5/c1-23-16(20)8-9-19-17(21)15(24-18(19)22)11-12-6-7-13-4-2-3-5-14(13)10-12/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | HKTZPXRUQBXUMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|