C33H37NO3 — CID 10074518
2-[2-tert-butyl-6-[(E)-2-[4-[hexyl(methyl)amino]phenyl]ethenyl]pyran-4-ylidene]indene-1,3-dione (PubChem CID 10074518) has the molecular formula C33H37NO3 and a molecular weight of 495.66 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[(E)-2-[4-[hexyl(methyl)amino]phenyl]ethenyl]pyran-4-ylidene]indene-1,3-dione.
| Compound Name | 2-[2-tert-butyl-6-[(E)-2-[4-[hexyl(methyl)amino]phenyl]ethenyl]pyran-4-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 10074518 |
| Molecular Formula | C33H37NO3 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 2-[2-tert-butyl-6-[(E)-2-[4-[hexyl(methyl)amino]phenyl]ethenyl]pyran-4-ylidene]indene-1,3-dione |
| SMILES | CCCCCCN(C)c1ccc(/C=C/C2=CC(=C3C(=O)c4ccccc4C3=O)C=C(C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C33H37NO3/c1-6-7-8-11-20-34(5)25-17-14-23(15-18-25)16-19-26-21-24(22-29(37-26)33(2,3)4)30-31(35)27-12-9-10-13-28(27)32(30)36/h9-10,12-19,21-22H,6-8,11,20H2,1-5H3/b19-16+ |
| InChIKey | NWSXSVBDTXHYSO-KNTRCKAVSA-N |
| XLogP | 7.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|