C34H29NO2 — CID 132511285
2-[1-ethyl-2,6-bis[(E)-2-(4-methylphenyl)ethenyl]-4-pyridinylidene]indene-1,3-dione (PubChem CID 132511285) has the molecular formula C34H29NO2 and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[1-ethyl-2,6-bis[(E)-2-(4-methylphenyl)ethenyl]-4-pyridinylidene]indene-1,3-dione.
| Compound Name | 2-[1-ethyl-2,6-bis[(E)-2-(4-methylphenyl)ethenyl]-4-pyridinylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 132511285 |
| Molecular Formula | C34H29NO2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-[1-ethyl-2,6-bis[(E)-2-(4-methylphenyl)ethenyl]-4-pyridinylidene]indene-1,3-dione |
| SMILES | CCN1C(/C=C/c2ccc(C)cc2)=CC(=C2C(=O)c3ccccc3C2=O)C=C1/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C34H29NO2/c1-4-35-28(19-17-25-13-9-23(2)10-14-25)21-27(22-29(35)20-18-26-15-11-24(3)12-16-26)32-33(36)30-7-5-6-8-31(30)34(32)37/h5-22H,4H2,1-3H3/b19-17+,20-18+ |
| InChIKey | OGQFHCWNNWTQCU-XPWSMXQVSA-N |
| XLogP | 7.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|