C15H11ClFNO3S — CID 67505503
1-(4-chlorophenyl)sulfonyl-6-fluoro-2,3-dihydroquinolin-4-one (PubChem CID 67505503) has the molecular formula C15H11ClFNO3S and a molecular weight of 339.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-6-fluoro-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-6-fluoro-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 67505503 |
| Molecular Formula | C15H11ClFNO3S |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-6-fluoro-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccc(Cl)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C15H11ClFNO3S/c16-10-1-4-12(5-2-10)22(20,21)18-8-7-15(19)13-9-11(17)3-6-14(13)18/h1-6,9H,7-8H2 |
| InChIKey | QORUKSSHJDKASJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |