C17H11ClFNO6S — CID 123606327
2-[1-(4-chlorophenyl)sulfonyl-6-fluoro-4-oxo-2,3-dihydroquinolin-3-yl]-2-oxoacetic acid (PubChem CID 123606327) has the molecular formula C17H11ClFNO6S and a molecular weight of 411.79 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonyl-6-fluoro-4-oxo-2,3-dihydroquinolin-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonyl-6-fluoro-4-oxo-2,3-dihydroquinolin-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 123606327 |
| Molecular Formula | C17H11ClFNO6S |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonyl-6-fluoro-4-oxo-2,3-dihydroquinolin-3-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)C1CN(S(=O)(=O)c2ccc(Cl)cc2)c2ccc(F)cc2C1=O |
| InChI | InChI=1S/C17H11ClFNO6S/c18-9-1-4-11(5-2-9)27(25,26)20-8-13(16(22)17(23)24)15(21)12-7-10(19)3-6-14(12)20/h1-7,13H,8H2,(H,23,24) |
| InChIKey | UYCPAAQYFZZDLS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|