C15H12F2N2O3S — CID 95318621
(3R)-1-(3,4-difluorophenyl)sulfonyl-2,3-dihydroindole-3-carboxamide (PubChem CID 95318621) has the molecular formula C15H12F2N2O3S and a molecular weight of 338.34 g/mol. Its IUPAC name is (3R)-1-(3,4-difluorophenyl)sulfonyl-2,3-dihydroindole-3-carboxamide.
| Compound Name | (3R)-1-(3,4-difluorophenyl)sulfonyl-2,3-dihydroindole-3-carboxamide |
|---|---|
| PubChem CID | 95318621 |
| Molecular Formula | C15H12F2N2O3S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | (3R)-1-(3,4-difluorophenyl)sulfonyl-2,3-dihydroindole-3-carboxamide |
| SMILES | NC(=O)[C@H]1CN(S(=O)(=O)c2ccc(F)c(F)c2)c2ccccc21 |
| InChI | InChI=1S/C15H12F2N2O3S/c16-12-6-5-9(7-13(12)17)23(21,22)19-8-11(15(18)20)10-3-1-2-4-14(10)19/h1-7,11H,8H2,(H2,18,20)/t11-/m0/s1 |
| InChIKey | QBFUXGPVUYIWQL-NSHDSACASA-N |
| XLogP | 1.74 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |