C15H13F2NO2S2 — CID 9167394
5-(3,4-difluorophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 9167394) has the molecular formula C15H13F2NO2S2 and a molecular weight of 341.40 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine.
| Compound Name | 5-(3,4-difluorophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 9167394 |
| Molecular Formula | C15H13F2NO2S2 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 5-(3,4-difluorophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCCSc2ccccc21 |
| InChI | InChI=1S/C15H13F2NO2S2/c16-12-7-6-11(10-13(12)17)22(19,20)18-8-3-9-21-15-5-2-1-4-14(15)18/h1-2,4-7,10H,3,8-9H2 |
| InChIKey | KIPXCCVUJBRHQZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |