C15H16N2O4S3 — CID 8823595
4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylsulfonyl)benzenesulfonamide (PubChem CID 8823595) has the molecular formula C15H16N2O4S3 and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylsulfonyl)benzenesulfonamide.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8823595 |
| Molecular Formula | C15H16N2O4S3 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylsulfonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCCSc3ccccc32)cc1 |
| InChI | InChI=1S/C15H16N2O4S3/c16-23(18,19)12-6-8-13(9-7-12)24(20,21)17-10-3-11-22-15-5-2-1-4-14(15)17/h1-2,4-9H,3,10-11H2,(H2,16,18,19) |
| InChIKey | DOZKVAQBVBPBQN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |