C15H12N2O2S2 — CID 110713083
2-(2,3-dihydro-1,4-benzothiazin-4-ylsulfonyl)benzonitrile (PubChem CID 110713083) has the molecular formula C15H12N2O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzothiazin-4-ylsulfonyl)benzonitrile.
| Compound Name | 2-(2,3-dihydro-1,4-benzothiazin-4-ylsulfonyl)benzonitrile |
|---|---|
| PubChem CID | 110713083 |
| Molecular Formula | C15H12N2O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzothiazin-4-ylsulfonyl)benzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCSc2ccccc21 |
| InChI | InChI=1S/C15H12N2O2S2/c16-11-12-5-1-4-8-15(12)21(18,19)17-9-10-20-14-7-3-2-6-13(14)17/h1-8H,9-10H2 |
| InChIKey | XCYASLZJDFOUHP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |