C18H16N2O3S — CID 110737760
2-[(6-acetyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzonitrile (PubChem CID 110737760) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-[(6-acetyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzonitrile.
| Compound Name | 2-[(6-acetyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 110737760 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-[(6-acetyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzonitrile |
| SMILES | CC(=O)c1ccc2c(c1)CCCN2S(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C18H16N2O3S/c1-13(21)14-8-9-17-15(11-14)6-4-10-20(17)24(22,23)18-7-3-2-5-16(18)12-19/h2-3,5,7-9,11H,4,6,10H2,1H3 |
| InChIKey | QQPNLFNLCLFVQC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |